|
CAS#: 59156-98-8 Product: 2,3,4,9-Tetrahydro-2-methyl-1H-Pyrido[3,4-b]indol-1-one No suppilers available for the product. |
| Name | 2,3,4,9-Tetrahydro-2-methyl-1H-Pyrido[3,4-b]indol-1-one |
|---|---|
| Synonyms | 2-Methyl-4,9-Dihydro-3H-$B-Carbolin-1-One; Strychnocarpine; 1H-Pyrido(3,4-B)Indol-1-One, 2,3,4,9-Tetrahydro-2-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 |
| CAS Registry Number | 59156-98-8 |
| SMILES | C1=CC=CC2=C1C3=C([NH]2)C(=O)N(CC3)C |
| InChI | 1S/C12H12N2O/c1-14-7-6-9-8-4-2-3-5-10(8)13-11(9)12(14)15/h2-5,13H,6-7H2,1H3 |
| InChIKey | HBJBUERIDCPCHJ-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.544°C at 760 mmHg (Cal.) |
| Flash point | 217.209°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,9-Tetrahydro-2-methyl-1H-Pyrido[3,4-b]indol-1-one |