|
CAS#: 60043-08-5 Product: N-[3,5-Bis(1,1-Dimethylethyl)-2-Hydroxyphenyl]Acetamide No suppilers available for the product. |
| Name | N-[3,5-Bis(1,1-Dimethylethyl)-2-Hydroxyphenyl]Acetamide |
|---|---|
| Synonyms | N-(3,5-Ditert-Butyl-2-Hydroxy-Phenyl)Acetamide; N-(3,5-Ditert-Butyl-2-Hydroxy-Phenyl)Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 |
| CAS Registry Number | 60043-08-5 |
| EINECS | 262-033-9 |
| SMILES | C1=C(C(C)(C)C)C=C(NC(=O)C)C(=C1C(C)(C)C)O |
| InChI | 1S/C16H25NO2/c1-10(18)17-13-9-11(15(2,3)4)8-12(14(13)19)16(5,6)7/h8-9,19H,1-7H3,(H,17,18) |
| InChIKey | CHAOLRKYRZZMKR-UHFFFAOYSA-N |
| Density | 1.036g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.528°C at 760 mmHg (Cal.) |
| Flash point | 175.47°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[3,5-Bis(1,1-Dimethylethyl)-2-Hydroxyphenyl]Acetamide |