|
CAS#: 601-58-1 Product: Stigmastane No suppilers available for the product. |
| Name | Stigmastane |
|---|---|
| Synonyms | CHEBI:26773 |
| Molecular Structure | ![]() |
| Molecular Formula | C29H52 |
| Molecular Weight | 400.72 |
| CAS Registry Number | 601-58-1 |
| SMILES | C41CCCC[C@@]1([C@@H]3[C@H]([C@@H]2CC[C@@H]([C@@]2(C)CC3)[C@H](C)CC[C@@H](CC)C(C)C)CC4)C |
| InChI | 1S/C29H52/c1-7-22(20(2)3)12-11-21(4)25-15-16-26-24-14-13-23-10-8-9-18-28(23,5)27(24)17-19-29(25,26)6/h20-27H,7-19H2,1-6H3/t21-,22-,23?,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | GKBHKNPLNHLYHT-LWQAOISPSA-N |
| Density | 0.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.144°C at 760 mmHg (Cal.) |
| Flash point | 224.087°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Stigmastane |