|
CAS#: 60124-85-8 Product: 2-Methyl-3-(2-Methylphenyl)-4(3H)-(2H4)Quinazolinone No suppilers available for the product. |
| Name | 2-Methyl-3-(2-Methylphenyl)-4(3H)-(2H4)Quinazolinone |
|---|---|
| Synonyms | 2-Methyl-3-(2-methylphenyl)-4(3H)-quinazolinone-5,6,7,8-d4 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10D4N2O |
| Molecular Weight | 254.32 |
| CAS Registry Number | 60124-85-8 |
| SMILES | [2H]c1c(c(c2c(c1[2H])c(=O)n(c(n2)C)c3ccccc3C)[2H])[2H] |
| InChI | 1S/C16H14N2O/c1-11-7-3-6-10-15(11)18-12(2)17-14-9-5-4-8-13(14)16(18)19/h3-10H,1-2H3/i4D,5D,8D,9D |
| InChIKey | JEYCTXHKTXCGPB-DOGSKSIHSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.904°C at 760 mmHg (Cal.) |
| Flash point | 199.889°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3-(2-Methylphenyl)-4(3H)-(2H4)Quinazolinone |