|
CAS#: 60257-28-5 Product: 6-Methylchromene-2-Thione No suppilers available for the product. |
| Name | 6-Methylchromene-2-Thione |
|---|---|
| Synonyms | 6-Methyl-2-Chromenethione; 2H-1-Benzopyran-2-Thione, 6-Methyl-; 6-Mtc |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8OS |
| Molecular Weight | 176.23 |
| CAS Registry Number | 60257-28-5 |
| SMILES | C1=C2C(=CC(=C1)C)C=CC(O2)=S |
| InChI | 1S/C10H8OS/c1-7-2-4-9-8(6-7)3-5-10(12)11-9/h2-6H,1H3 |
| InChIKey | SSRXJDKHMCDORD-UHFFFAOYSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.543°C at 760 mmHg (Cal.) |
| Flash point | 116.211°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methylchromene-2-Thione |