|
CAS#: 60263-07-2 Product: Jacaranone No suppilers available for the product. |
| Name | Jacaranone |
|---|---|
| Synonyms | 2-(1-Hydroxy-4-Oxo-1-Cyclohexa-2,5-Dienyl)Acetic Acid Methyl Ester; 2-(1-Hydroxy-4-Keto-1-Cyclohexa-2,5-Dienyl)Acetic Acid Methyl Ester; Methyl 2-(1-Hydroxy-4-Oxo-1-Cyclohexa-2,5-Dienyl)Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.18 |
| CAS Registry Number | 60263-07-2 |
| SMILES | C(C1(C=CC(=O)C=C1)O)C(=O)OC |
| InChI | 1S/C9H10O4/c1-13-8(11)6-9(12)4-2-7(10)3-5-9/h2-5,12H,6H2,1H3 |
| InChIKey | WJZSKNRPRWCLLK-UHFFFAOYSA-N |
| Density | 1.278g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.121°C at 760 mmHg (Cal.) |
| Flash point | 132.504°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Jacaranone |