Online Database of Chemicals from Around the World
|
CAS#: 60342-43-0 Product: Govadine No suppilers available for the product. |
| Name | Govadine |
|---|---|
| Synonyms | Govadine; 5,8,13,13A-Tetrahydro-3,11-Dimethoxy-6H-Dibenzo(A,G)Quinolizine-2,10-Diol; 6H-Dibenzo(A,G)Quinolizine-2,10-Diol, 5,8,13,13A-Tetrahydro-3,11-Dimethoxy-, (S)- |
| Molecular Structure |  |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 |
| CAS Registry Number | 60342-43-0 |
| SMILES | [C@H]23N(CC1=CC(=C(OC)C=C1C2)O)CCC4=CC(=C(O)C=C34)OC |
| InChI | 1S/C19H21NO4/c1-23-18-7-11-3-4-20-10-13-6-16(21)19(24-2)8-12(13)5-15(20)14(11)9-17(18)22/h6-9,15,21-22H,3-5,10H2,1-2H3/t15-/m0/s1 |
| InChIKey | FQPSOJRHFJUUMC-HNNXBMFYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.902°C at 760 mmHg (Cal.) |
| Flash point | 265.808°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Govadine |