|
CAS#: 60580-60-1 Product: Lead 5-Nitroterephthalate No suppilers available for the product. |
| Name | Lead 5-Nitroterephthalate |
|---|---|
| Synonyms | Plumbous 2-Nitroterephthalate; Lead 5-Nitroterephthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H3NO6Pb |
| Molecular Weight | 416.31 |
| CAS Registry Number | 60580-60-1 |
| EINECS | 262-308-3 |
| SMILES | C1=C(C=CC(=C1[N+]([O-])=O)C([O-])=O)C([O-])=O.[Pb++] |
| InChI | 1S/C8H5NO6.Pb/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;/h1-3H,(H,10,11)(H,12,13);/q;+2/p-2 |
| InChIKey | BBUSXYPIFFHFHF-UHFFFAOYSA-L |
| Boiling point | 454.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lead 5-Nitroterephthalate |