| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Analytical chemistry >> Standard >> Forensic and veterinary standards |
|---|---|
| Name | Codeine Monohydrate |
| Synonyms | Brontex; Codeine [Ban]; Dea No. 9050 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 |
| CAS Registry Number | 6059-47-8 |
| SMILES | [C@]124[C@@H]5[C@H](N(CC1)C)CC3=C2C(=C(OC)C=C3)O[C@H]4[C@@H](O)C=C5.O |
| InChI | 1S/C18H21NO3.H2O/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19;/h3-6,11-13,17,20H,7-9H2,1-2H3;1H2/t11-,12+,13-,17-,18-;/m0./s1 |
| InChIKey | WRRSFOZOETZUPG-FFHNEAJVSA-N |
| Boiling point | 462°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 233.2°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Codeine Monohydrate |