|
CAS#: 60595-60-0 Product: 2,5,8-Trimethyl-4H-1-Benzopyran-4-One No suppilers available for the product. |
| Name | 2,5,8-Trimethyl-4H-1-Benzopyran-4-One |
|---|---|
| Synonyms | 2,5,8-Trimethyl-4-Chromenone; 2,5,8-Trimethylchromone; 2,5,8-Trimethyl-4H-1-Benzopyran-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 |
| CAS Registry Number | 60595-60-0 |
| SMILES | C1=C(C2=C(C(=C1)C)OC(=CC2=O)C)C |
| InChI | 1S/C12H12O2/c1-7-4-5-8(2)12-11(7)10(13)6-9(3)14-12/h4-6H,1-3H3 |
| InChIKey | KJRCVOWXLZJQKW-UHFFFAOYSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.507°C at 760 mmHg (Cal.) |
| Flash point | 141.086°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5,8-Trimethyl-4H-1-Benzopyran-4-One |