|
CAS#: 606-07-5 Product: 1,2,3,4,5-Pentachloro-6-Ethyl-Benzene No suppilers available for the product. |
| Name | 1,2,3,4,5-Pentachloro-6-Ethyl-Benzene |
|---|---|
| Synonyms | 1,2,3,4,5-Pentachloro-6-Ethyl-Benzene; Nsc1856; Pentachloroethylbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl5 |
| Molecular Weight | 278.39 |
| CAS Registry Number | 606-07-5 |
| SMILES | C(C1=C(C(=C(Cl)C(=C1Cl)Cl)Cl)Cl)C |
| InChI | 1S/C8H5Cl5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H2,1H3 |
| InChIKey | JBLPFPMLHWDSFR-UHFFFAOYSA-N |
| Density | 1.53g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.431°C at 760 mmHg (Cal.) |
| Flash point | 137.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5-Pentachloro-6-Ethyl-Benzene |