Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 4-Phenylazophenacyl Bromide |
|---|---|
| Synonyms | 2-Bromo-1-(4-Phenylazophenyl)Ethanone; Ethanone, 2-Bromo-1-(4-(Phenylazo)Phenyl)-; 2-Bromo-1-[4-(Phenyldiazenyl)Phenyl]Ethanone |
| Molecular Structure |  |
| Molecular Formula | C14H11BrN2O |
| Molecular Weight | 303.16 |
| CAS Registry Number | 62625-24-5 |
| SMILES | C1=C(C(CBr)=O)C=CC(=C1)N=NC2=CC=CC=C2 |
| InChI | 1S/C14H11BrN2O/c15-10-14(18)11-6-8-13(9-7-11)17-16-12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | ZXTGCMLCYPYCID-UHFFFAOYSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Melting point | 104°C (Expl.) |
| Boiling point | 426.989°C at 760 mmHg (Cal.) |
| Flash point | 212.036°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Phenylazophenacyl Bromide |