|
CAS#: 6334-29-8 Product: 1-[2-(4-Chlorophenyl)Quinolin-4-Yl]Ethanol No suppilers available for the product. |
| Name | 1-[2-(4-Chlorophenyl)Quinolin-4-Yl]Ethanol |
|---|---|
| Synonyms | 1-[2-(4-Chlorophenyl)-4-Quinolyl]Ethanol; Nsc25676 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14ClNO |
| Molecular Weight | 283.76 |
| CAS Registry Number | 6334-29-8 |
| SMILES | C1=CC(=CC=C1C3=NC2=C(C=CC=C2)C(=C3)C(C)O)Cl |
| InChI | 1S/C17H14ClNO/c1-11(20)15-10-17(12-6-8-13(18)9-7-12)19-16-5-3-2-4-14(15)16/h2-11,20H,1H3 |
| InChIKey | LLUZAYZRXRQYBD-UHFFFAOYSA-N |
| Density | 1.261g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.154°C at 760 mmHg (Cal.) |
| Flash point | 239.35°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-(4-Chlorophenyl)Quinolin-4-Yl]Ethanol |