|
CAS#: 63918-79-6 Product: Isopentyl Pentachlorophenyl Ether No suppilers available for the product. |
| Name | Isopentyl Pentachlorophenyl Ether |
|---|---|
| Synonyms | 1,2,3,4,5-Pentachloro-6-Isopentyloxy-Benzene; 1,2,3,4,5-Pentachloro-6-Isopentyloxybenzene; 1,2,3,4,5-Pentachloro-6-Isoamoxy-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11Cl5O |
| Molecular Weight | 336.47 |
| CAS Registry Number | 63918-79-6 |
| SMILES | C(OC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)CC(C)C |
| InChI | 1S/C11H11Cl5O/c1-5(2)3-4-17-11-9(15)7(13)6(12)8(14)10(11)16/h5H,3-4H2,1-2H3 |
| InChIKey | PKDCVWRKTAWUET-UHFFFAOYSA-N |
| Density | 1.404g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.694°C at 760 mmHg (Cal.) |
| Flash point | 129.046°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopentyl Pentachlorophenyl Ether |