|
CAS#: 64503-07-7 Product: Benzyl Dibromoacetate No suppilers available for the product. |
| Name | Benzyl Dibromoacetate |
|---|---|
| Synonyms | 2,2-Dibromoacetic Acid Phenylmethyl Ester; 2,2-Dibromoacetic Acid Benzyl Ester; Phenylmethyl 2,2-Dibromoethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8Br2O2 |
| Molecular Weight | 307.97 |
| CAS Registry Number | 64503-07-7 |
| EINECS | 264-926-9 |
| SMILES | C1=CC=CC=C1COC(C(Br)Br)=O |
| InChI | 1S/C9H8Br2O2/c10-8(11)9(12)13-6-7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | QYFPTUAHIPBRJK-UHFFFAOYSA-N |
| Density | 1.823g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.547°C at 760 mmHg (Cal.) |
| Flash point | 141.614°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzyl Dibromoacetate |