|
CAS#: 650615-91-1 Product: Ethyl 3-methyl-5-(methylsulfanyl)-4-vinyl-2-thiophenecarboxylate No suppilers available for the product. |
| Name | Ethyl 3-methyl-5-(methylsulfanyl)-4-vinyl-2-thiophenecarboxylate |
|---|---|
| Synonyms | ethyl 3-methyl-5-(methylthio)-4-vinylthiophene-2-carboxylate; ZINC00161081 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O2S2 |
| Molecular Weight | 242.36 |
| CAS Registry Number | 650615-91-1 |
| SMILES | O=C(OCC)c1sc(SC)c(\C=C)c1C |
| InChI | 1S/C11H14O2S2/c1-5-8-7(3)9(10(12)13-6-2)15-11(8)14-4/h5H,1,6H2,2-4H3 |
| InChIKey | FFNYJXHQCYRVHF-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.401°C at 760 mmHg (Cal.) |
| Flash point | 160.879°C (Cal.) |
| Refractive index | 1.562 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-methyl-5-(methylsulfanyl)-4-vinyl-2-thiophenecarboxylate |