|
CAS#: 65718-85-6 Product: (3R,4S)-6,8-Dihydroxy-3,4,5-trimethyl-1-oxo-3,4-dihydro-1H-isochromene-7-carboxylic acid No suppilers available for the product. |
| Name | (3R,4S)-6,8-Dihydroxy-3,4,5-trimethyl-1-oxo-3,4-dihydro-1H-isochromene-7-carboxylic acid |
|---|---|
| Synonyms | (3R,4S)-6,8-Dihydroxy-3,4,5-Trimethyl-1-Oxo-Isochroman-7-Carboxylic Acid; (3R,4S)-6,8-Dihydroxy-3,4,5-Trimethyl-1-Oxo-7-Isochromancarboxylic Acid; (3R,4S)-6,8-Dihydroxy-1-Keto-3,4,5-Trimethyl-Isochroman-7-Carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 |
| CAS Registry Number | 65718-85-6 |
| SMILES | [C@@H]2(C1=C(C(=C(C(=C1C(O[C@@H]2C)=O)O)C(=O)O)O)C)C |
| InChI | 1S/C13H14O6/c1-4-6(3)19-13(18)8-7(4)5(2)10(14)9(11(8)15)12(16)17/h4,6,14-15H,1-3H3,(H,16,17)/t4-,6-/m1/s1 |
| InChIKey | VVVMDYGNIVXIIG-INEUFUBQSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.581°C at 760 mmHg (Cal.) |
| Flash point | 196.633°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R,4S)-6,8-Dihydroxy-3,4,5-trimethyl-1-oxo-3,4-dihydro-1H-isochromene-7-carboxylic acid |