|
CAS#: 6633-67-6 Product: N4-(3-Chlorophenyl)Pyrimidine-2,4,6-Triamine No suppilers available for the product. |
| Name | N4-(3-Chlorophenyl)Pyrimidine-2,4,6-Triamine |
|---|---|
| Synonyms | (3-Chlorophenyl)-(2,6-Diaminopyrimidin-4-Yl)Amine; Nsc42136 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClN5 |
| Molecular Weight | 235.68 |
| CAS Registry Number | 6633-67-6 |
| SMILES | C1=C(Cl)C=CC=C1NC2=NC(=NC(=C2)N)N |
| InChI | 1S/C10H10ClN5/c11-6-2-1-3-7(4-6)14-9-5-8(12)15-10(13)16-9/h1-5H,(H5,12,13,14,15,16) |
| InChIKey | UBLVYMZBOMHJKQ-UHFFFAOYSA-N |
| Density | 1.488g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.519°C at 760 mmHg (Cal.) |
| Flash point | 271.02°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N4-(3-Chlorophenyl)Pyrimidine-2,4,6-Triamine |