|
CAS#: 6633-68-7 Product: N4-(3,4-Dichlorophenyl)Pyrimidine-2,4,6-Triamine No suppilers available for the product. |
| Name | N4-(3,4-Dichlorophenyl)Pyrimidine-2,4,6-Triamine |
|---|---|
| Synonyms | (2,6-Diaminopyrimidin-4-Yl)-(3,4-Dichlorophenyl)Amine; Nsc42137 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9Cl2N5 |
| Molecular Weight | 270.12 |
| CAS Registry Number | 6633-68-7 |
| SMILES | C2=C(NC1=CC(=NC(=N1)N)N)C=CC(=C2Cl)Cl |
| InChI | 1S/C10H9Cl2N5/c11-6-2-1-5(3-7(6)12)15-9-4-8(13)16-10(14)17-9/h1-4H,(H5,13,14,15,16,17) |
| InChIKey | WSFJSICRAQCIFB-UHFFFAOYSA-N |
| Density | 1.585g/cm3 (Cal.) |
|---|---|
| Boiling point | 542.047°C at 760 mmHg (Cal.) |
| Flash point | 281.62°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N4-(3,4-Dichlorophenyl)Pyrimidine-2,4,6-Triamine |