|
CAS#: 66879-58-1 Product: Exo-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Propionic Acid No suppilers available for the product. |
| Name | Exo-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Propionic Acid |
|---|---|
| Synonyms | 3-(3,3-Dimethylnorbornan-2-Yl)Propanoic Acid; 3-(3,3-Dimethyl-2-Norbornanyl)Propanoic Acid; 3-(3,3-Dimethylnorbornan-2-Yl)Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 66879-58-1 |
| EINECS | 266-507-6 |
| SMILES | C(C1C(C2CC1CC2)(C)C)CC(=O)O |
| InChI | 1S/C12H20O2/c1-12(2)9-4-3-8(7-9)10(12)5-6-11(13)14/h8-10H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | PECZKENMPPVTAH-UHFFFAOYSA-N |
| Density | 1.021g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.775°C at 760 mmHg (Cal.) |
| Flash point | 141.608°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Exo-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Propionic Acid |