|
CAS#: 66975-11-9 Product: 1-(4-Tolyl)-3-Acetyl-3-Methyltriazene No suppilers available for the product. |
| Name | 1-(4-Tolyl)-3-Acetyl-3-Methyltriazene |
|---|---|
| Synonyms | N-Methyl-N-(4-Methylphenyl)Azo-Acetamide; N-Methyl-N-(4-Methylphenyl)Azoacetamide; N-Methyl-N-(4-Methylphenyl)Diazenyl-Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 |
| CAS Registry Number | 66975-11-9 |
| SMILES | C1=CC(=CC=C1N=NN(C)C(C)=O)C |
| InChI | 1S/C10H13N3O/c1-8-4-6-10(7-5-8)11-12-13(3)9(2)14/h4-7H,1-3H3 |
| InChIKey | YWZSIEORQZIPIT-UHFFFAOYSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.897°C at 760 mmHg (Cal.) |
| Flash point | 123.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Tolyl)-3-Acetyl-3-Methyltriazene |