|
CAS#: 6725-72-0 Product: Methyl Phenyl Terephthalate No suppilers available for the product. |
| Name | Methyl Phenyl Terephthalate |
|---|---|
| Synonyms | Benzene-1,4-Dicarboxylic Acid O4-Methyl O1-Phenyl Ester; Methyl Phenyl Terephthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 |
| CAS Registry Number | 6725-72-0 |
| EINECS | 229-777-6 |
| SMILES | C2=C(C(OC1=CC=CC=C1)=O)C=CC(=C2)C(OC)=O |
| InChI | 1S/C15H12O4/c1-18-14(16)11-7-9-12(10-8-11)15(17)19-13-5-3-2-4-6-13/h2-10H,1H3 |
| InChIKey | BDVAPCAHRXXXOF-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.93°C at 760 mmHg (Cal.) |
| Flash point | 204.046°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl Phenyl Terephthalate |