|
CAS#: 673-19-8 Product: 3-Sec-Butylphenyl N-Methylcarbamate No suppilers available for the product. |
| Name | 3-Sec-Butylphenyl N-Methylcarbamate |
|---|---|
| Synonyms | (3-Sec-Butylphenyl) N-Methylcarbamate; N-Methylcarbamic Acid (3-Sec-Butylphenyl) Ester; 3-(1-Methylpropyl)Phenol Methylcarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 |
| CAS Registry Number | 673-19-8 |
| SMILES | C1=CC(=CC(=C1)OC(=O)NC)C(CC)C |
| InChI | 1S/C12H17NO2/c1-4-9(2)10-6-5-7-11(8-10)15-12(14)13-3/h5-9H,4H2,1-3H3,(H,13,14) |
| InChIKey | NTZPCBGVBWXEOC-UHFFFAOYSA-N |
| Density | 1.024g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.783°C at 760 mmHg (Cal.) |
| Flash point | 122.404°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Sec-Butylphenyl N-Methylcarbamate |