|
CAS#: 67881-18-9 Product: Phenylditolylmethane No suppilers available for the product. |
| Name | Phenylditolylmethane |
|---|---|
| Synonyms | 1-Methyl-2-[(2-Methylphenyl)-Phenyl-Methyl]Benzene; Benzene, 1,1'-(Phenylmethylene)Bis(Methyl-; Nsc29127 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 |
| CAS Registry Number | 67881-18-9 |
| SMILES | [C@H](C1=C(C)C=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3C |
| InChI | 1S/C21H20/c1-16-10-6-8-14-19(16)21(18-12-4-3-5-13-18)20-15-9-7-11-17(20)2/h3-15,21H,1-2H3 |
| InChIKey | FXEMFMZCJUUOPF-UHFFFAOYSA-N |
| Density | 1.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.464°C at 760 mmHg (Cal.) |
| Flash point | 184.378°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenylditolylmethane |