|
CAS#: 67886-68-4 Product: 2-Chloro-6-Methoxynaphthalene No suppilers available for the product. |
| Name | 2-Chloro-6-Methoxynaphthalene |
|---|---|
| Synonyms | 2-Chloro-6-Methoxy-Naphthalene; Naphthalene, 2-Chloro-6-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9ClO |
| Molecular Weight | 192.64 |
| CAS Registry Number | 67886-68-4 |
| EINECS | 267-555-0 |
| SMILES | C1=C(OC)C=CC2=C1C=CC(=C2)Cl |
| InChI | 1S/C11H9ClO/c1-13-11-5-3-8-6-10(12)4-2-9(8)7-11/h2-7H,1H3 |
| InChIKey | DFJBXCAVJOGNDS-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.922°C at 760 mmHg (Cal.) |
| Flash point | 139.413°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-6-Methoxynaphthalene |