|
CAS#: 67886-69-5 Product: 2-Iodo-6-Methoxy-Naphthalene No suppilers available for the product. |
| Name | 2-Iodo-6-Methoxy-Naphthalene |
|---|---|
| Synonyms | 2-Iodo-6-Methoxy-Naphthalene; Nsc408622 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9IO |
| Molecular Weight | 284.10 |
| CAS Registry Number | 67886-69-5 |
| SMILES | C1=C(C=CC2=C1C=CC(=C2)I)OC |
| InChI | 1S/C11H9IO/c1-13-11-5-3-8-6-10(12)4-2-9(8)7-11/h2-7H,1H3 |
| InChIKey | RATKEICSZQPVCV-UHFFFAOYSA-N |
| Density | 1.675g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.667°C at 760 mmHg (Cal.) |
| Flash point | 164.063°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Iodo-6-Methoxy-Naphthalene |