|
CAS#: 67888-97-5 Product: 2,4,5,3',4'-Pentabromobiphenyl No suppilers available for the product. |
| Name | 2,4,5,3',4'-Pentabromobiphenyl |
|---|---|
| Synonyms | 1,1'-Biphenyl, 2,3',4,4',5-Pentabromo-; 2,3',4,4',5-Pentabromo-1,1'-Biphenyl; 2,4,5,3',4'-Pentabromobiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H5Br5 |
| Molecular Weight | 548.69 |
| CAS Registry Number | 67888-97-5 |
| SMILES | C1=C(C(=CC(=C1C2=CC(=C(C=C2)Br)Br)Br)Br)Br |
| InChI | 1S/C12H5Br5/c13-8-2-1-6(3-10(8)15)7-4-11(16)12(17)5-9(7)14/h1-5H |
| InChIKey | YOQVIFKWRYWBEP-UHFFFAOYSA-N |
| Density | 2.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.945°C at 760 mmHg (Cal.) |
| Flash point | 219.763°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5,3',4'-Pentabromobiphenyl |