|
CAS#: 67892-46-0 Product: 3-Amino-5-Chloro-4-Ethylbenzenesulphonic Acid No suppilers available for the product. |
| Name | 3-Amino-5-Chloro-4-Ethylbenzenesulphonic Acid |
|---|---|
| Synonyms | 3-Amino-5-Chloro-4-Ethyl-Benzenesulfonic Acid; 3-Amino-5-Chloro-4-Ethylbenzenesulphonic Acid; Benzenesulfonic Acid, 3-Amino-5-Chloro-4-Ethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10ClNO3S |
| Molecular Weight | 235.68 |
| CAS Registry Number | 67892-46-0 |
| EINECS | 267-579-1 |
| SMILES | C1=C([S](=O)(=O)O)C=C(C(=C1Cl)CC)N |
| InChI | 1S/C8H10ClNO3S/c1-2-6-7(9)3-5(4-8(6)10)14(11,12)13/h3-4H,2,10H2,1H3,(H,11,12,13) |
| InChIKey | ZXFQJBRYWYWLAM-UHFFFAOYSA-N |
| Density | 1.48g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Amino-5-Chloro-4-Ethylbenzenesulphonic Acid |