|
CAS#: 68928-51-8 Product: 1,3,5-Trithiane-2,4,6-Tricarboxylic Acid No suppilers available for the product. |
| Name | 1,3,5-Trithiane-2,4,6-Tricarboxylic Acid |
|---|---|
| Synonyms | 2,4,6-Tricarboxy-1,3,5-Trithiane |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6O6S3 |
| Molecular Weight | 270.29 |
| CAS Registry Number | 68928-51-8 |
| EINECS | 273-020-2 |
| SMILES | O=C(C1SC(SC(S1)C(=O)O)C(=O)O)O |
| InChI | 1S/C6H6O6S3/c7-1(8)4-13-5(2(9)10)15-6(14-4)3(11)12/h4-6H,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | VZFJMKRFMNCZSK-UHFFFAOYSA-N |
| Density | 1.908g/cm3 (Cal.) |
|---|---|
| Boiling point | 692.233°C at 760 mmHg (Cal.) |
| Flash point | 372.45°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Trithiane-2,4,6-Tricarboxylic Acid |