|
CAS#: 71097-53-5 Product: 4-(5-Methyl-2-Furyl)Pentan-2-One No suppilers available for the product. |
| Name | 4-(5-Methyl-2-Furyl)Pentan-2-One |
|---|---|
| Synonyms | 4-(5-Methyl-2-Furyl)Pentan-2-One; Inchi=1/C10h14o2/C1-7(6-8(2)11)10-5-4-9(3)12-10/H4-5,7H,6H2,1-3H |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 |
| CAS Registry Number | 71097-53-5 |
| EINECS | 275-191-9 |
| SMILES | C1=C(OC(=C1)C)C(CC(=O)C)C |
| InChI | 1S/C10H14O2/c1-7(6-8(2)11)10-5-4-9(3)12-10/h4-5,7H,6H2,1-3H3 |
| InChIKey | SNCJRRZMGMKMBW-UHFFFAOYSA-N |
| Density | 0.985g/cm3 (Cal.) |
|---|---|
| Boiling point | 196.02°C at 760 mmHg (Cal.) |
| Flash point | 79.62°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(5-Methyl-2-Furyl)Pentan-2-One |