|
CAS#: 71823-44-4 Product: 1-Phenyl-5-Acenaphtheneacetic Acid No suppilers available for the product. |
| Name | 1-Phenyl-5-Acenaphtheneacetic Acid |
|---|---|
| Synonyms | 2-(1-Phenyl-5-Acenaphthenyl)Acetic Acid; 2-(1-Phenylacenaphthen-5-Yl)Ethanoic Acid; 1-Phenyl-5-Acenaphtheneacetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 |
| CAS Registry Number | 71823-44-4 |
| SMILES | C1=CC(=C2C=CC=C3C(CC1=C23)C4=CC=CC=C4)CC(=O)O |
| InChI | 1S/C20H16O2/c21-19(22)12-14-9-10-15-11-18(13-5-2-1-3-6-13)17-8-4-7-16(14)20(15)17/h1-10,18H,11-12H2,(H,21,22) |
| InChIKey | XRLCPYOJAVEXCC-UHFFFAOYSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.816°C at 760 mmHg (Cal.) |
| Flash point | 386.333°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-5-Acenaphtheneacetic Acid |