Online Database of Chemicals from Around the World
|
CAS#: 74309-58-3 Product: 3-(1-Phenylethenyl)Pyridine No suppilers available for the product. |
| Name | 3-(1-Phenylethenyl)Pyridine |
|---|---|
| Synonyms | 3-(1-Phenylvinyl)Pyridine; Pyridine,3-(1-Phenylethenyl)- |
| Molecular Structure |  |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 |
| CAS Registry Number | 74309-58-3 |
| SMILES | C2=C(C(C1=CC=CC=C1)=C)C=CC=N2 |
| InChI | 1S/C13H11N/c1-11(12-6-3-2-4-7-12)13-8-5-9-14-10-13/h2-10H,1H2 |
| InChIKey | AAEOSEDYHVWUIF-UHFFFAOYSA-N |
| Density | 1.035g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.619°C at 760 mmHg (Cal.) |
| Flash point | 121.812°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1-Phenylethenyl)Pyridine |