|
CAS#: 75332-50-2 Product: Ethyl (2E)-3-(4-ethoxy-3,5-dimethoxyphenyl)acrylate No suppilers available for the product. |
| Name | Ethyl (2E)-3-(4-ethoxy-3,5-dimethoxyphenyl)acrylate |
|---|---|
| Synonyms | Ethyl (2E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-2-propenoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 |
| CAS Registry Number | 75332-50-2 |
| SMILES | O=C(OCC)\C=C\c1cc(OC)c(OCC)c(OC)c1 |
| InChI | 1S/C15H20O5/c1-5-19-14(16)8-7-11-9-12(17-3)15(20-6-2)13(10-11)18-4/h7-10H,5-6H2,1-4H3/b8-7+ |
| InChIKey | OPAIXYIBCPAMEV-BQYQJAHWSA-N |
| Density | 1.097g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.314°C at 760 mmHg (Cal.) |
| Flash point | 174.24°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2E)-3-(4-ethoxy-3,5-dimethoxyphenyl)acrylate |