|
CAS#: 7534-35-2 Product: 1-Thio-beta-D-Glucopyranose No suppilers available for the product. |
| Name | 1-Thio-beta-D-Glucopyranose |
|---|---|
| Synonyms | 1-Thio-Beta-D-Glucose; 1-Thioglucose; Sodium Thioglucse |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O5S |
| Molecular Weight | 196.22 |
| CAS Registry Number | 7534-35-2 |
| SMILES | [C@H](O)([C@H](O)[C@H](O)CO)[C@@H](O)C=S |
| InChI | 1S/C6H12O5S/c7-1-3(8)5(10)6(11)4(9)2-12/h2-11H,1H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | ABXYOVCSAGTJAC-JGWLITMVSA-N |
| Density | 1.611g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.833°C at 760 mmHg (Cal.) |
| Flash point | 292.981°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Thio-beta-D-Glucopyranose |