| Indofine Chemical Company, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Perfluorohexene-1 |
|---|---|
| Synonyms | Perfluorohex-1-Ene |
| Molecular Structure | ![]() |
| Molecular Formula | C6F12 |
| Molecular Weight | 300.05 |
| CAS Registry Number | 755-25-9 |
| EINECS | 212-047-6 |
| SMILES | C(=C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)F)(F)F |
| InChI | 1S/C6F12/c7-1(2(8)9)3(10,11)4(12,13)5(14,15)6(16,17)18 |
| InChIKey | RMHCWMIZBMGHKV-UHFFFAOYSA-N |
| Density | 1.61g/cm3 (Cal.) |
|---|---|
| Boiling point | 57°C (Expl.) |
| 59.007°C at 760 mmHg (Cal.) | |
| Flash point | -0.034°C (Cal.) |
| Refractive index | 1.267 (Expl.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Perfluorohexene-1 |