|
CAS#: 77154-16-6 Product: N-{3-Chloro-4-[(4-hydroxy-3-biphenylyl)diazenyl]phenyl}acetamide No suppilers available for the product. |
| Name | N-{3-Chloro-4-[(4-hydroxy-3-biphenylyl)diazenyl]phenyl}acetamide |
|---|---|
| Synonyms | N-[3-chlo |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.81 |
| CAS Registry Number | 77154-16-6 |
| EINECS | 278-631-8 |
| SMILES | Clc3cc(ccc3N=Nc1cc(ccc1O)c2ccccc2)NC(C)=O |
| InChI | 1S/C20H16ClN3O2/c1-13(25)22-16-8-9-18(17(21)12-16)23-24-19-11-15(7-10-20(19)26)14-5-3-2-4-6-14/h2-12,26H,1H3,(H,22,25) |
| InChIKey | RUOWZMURTIZENY-UHFFFAOYSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 632.35°C at 760 mmHg (Cal.) |
| Flash point | 336.233°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-{3-Chloro-4-[(4-hydroxy-3-biphenylyl)diazenyl]phenyl}acetamide |