|
CAS#: 77529-06-7 Product: N-Methyl-1-(4,5,6,7-Tetrahydro-1,3-Benzothiazol-6-Yl)Methanamine Hydrochloride No suppilers available for the product. |
| Name | N-Methyl-1-(4,5,6,7-Tetrahydro-1,3-Benzothiazol-6-Yl)Methanamine Hydrochloride |
|---|---|
| Synonyms | Methyl-(4,5,6,7-Tetrahydro-1,3-Benzothiazol-6-Ylmethyl)Amine Hydrochloride; (N-Methylaminomethyl)-6 Tetrahydro-4,5,6,7-Benzo(D)Thiazole Chlorhydrate [French]; 4,5,6,7-Tetrahydro-N-Methyl-6-Benzothiazolemethanamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15ClN2S |
| Molecular Weight | 218.74 |
| CAS Registry Number | 77529-06-7 |
| SMILES | [H+].C1=NC2=C(S1)CC(CC2)CNC.[Cl-] |
| InChI | 1S/C9H14N2S.ClH/c1-10-5-7-2-3-8-9(4-7)12-6-11-8;/h6-7,10H,2-5H2,1H3;1H |
| InChIKey | SKBAKFNXRHAOMC-UHFFFAOYSA-N |
| Boiling point | 297.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 133.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-1-(4,5,6,7-Tetrahydro-1,3-Benzothiazol-6-Yl)Methanamine Hydrochloride |