Online Database of Chemicals from Around the World
|
CAS#: 80192-39-8 Product: 3,6-Dimethyl-3-Vinylhept-5-En-2-One No suppilers available for the product. |
| Name | 3,6-Dimethyl-3-Vinylhept-5-En-2-One |
|---|---|
| Synonyms | 3,6-Dimethyl-3-Vinyl-Hept-5-En-2-One; 3,6-Dimethyl-3-Vinylhept-5-En-2-One; 3-Ethenyl-3,6-Dimethyl-Hept-5-En-2-One |
| Molecular Structure |  |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 |
| CAS Registry Number | 80192-39-8 |
| EINECS | 279-416-1 |
| SMILES | C(C(C(=O)C)(C=C)C)C=C(C)C |
| InChI | 1S/C11H18O/c1-6-11(5,10(4)12)8-7-9(2)3/h6-7H,1,8H2,2-5H3 |
| InChIKey | DCDRFQMZVITJAD-UHFFFAOYSA-N |
| Density | 0.849g/cm3 (Cal.) |
|---|---|
| Boiling point | 229.65°C at 760 mmHg (Cal.) |
| Flash point | 78.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6-Dimethyl-3-Vinylhept-5-En-2-One |