|
CAS#: 80273-79-6 Product: Tefludazine No suppilers available for the product. |
| Name | Tefludazine |
|---|---|
| Synonyms | 2-[4-[(1R,3S)-3-(4-Fluorophenyl)-6-(Trifluoromethyl)Indan-1-Yl]Piperazin-1-Yl]Ethanol; 2-[4-[(1R,3S)-3-(4-Fluorophenyl)-6-(Trifluoromethyl)-1-Indanyl]-1-Piperazinyl]Ethanol; Tefludazinum [Latin] |
| Molecular Structure | ![]() |
| Molecular Formula | C22H24F4N2O |
| Molecular Weight | 408.44 |
| CAS Registry Number | 80273-79-6 |
| SMILES | [C@@H]2(C3=C([C@H](C1=CC=C(C=C1)F)C2)C=CC(=C3)C(F)(F)F)N4CCN(CCO)CC4 |
| InChI | 1S/C22H24F4N2O/c23-17-4-1-15(2-5-17)19-14-21(28-9-7-27(8-10-28)11-12-29)20-13-16(22(24,25)26)3-6-18(19)20/h1-6,13,19,21,29H,7-12,14H2/t19-,21+/m0/s1 |
| InChIKey | JSBWGXQXCRYYTG-PZJWPPBQSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.444°C at 760 mmHg (Cal.) |
| Flash point | 241.945°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tefludazine |