|
CAS#: 80308-82-3 Product: 1,7-Difluoro-1,1,5,7,7-Pentanitro-5-Aza-3-Oxaheptane No suppilers available for the product. |
| Name | 1,7-Difluoro-1,1,5,7,7-Pentanitro-5-Aza-3-Oxaheptane |
|---|---|
| Synonyms | N-[(2-Fluoro-2,2-Dinitro-Ethoxy)Methyl]-N-(2-Fluoro-2,2-Dinitro-Ethyl)Nitramide; 1,7-Difluoro-1,1,5,7,7-Pentanitro-5-Aza-3-Oxaheptane |
| Molecular Structure | ![]() |
| Molecular Formula | C5H6F2N6O11 |
| Molecular Weight | 364.13 |
| CAS Registry Number | 80308-82-3 |
| SMILES | C(N([N+]([O-])=O)COCC(F)([N+]([O-])=O)[N+]([O-])=O)C(F)([N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C5H6F2N6O11/c6-4(9(14)15,10(16)17)1-8(13(22)23)3-24-2-5(7,11(18)19)12(20)21/h1-3H2 |
| InChIKey | SOLZWBGEHVEJDE-UHFFFAOYSA-N |
| Density | 1.825g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.328°C at 760 mmHg (Cal.) |
| Flash point | 251.551°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7-Difluoro-1,1,5,7,7-Pentanitro-5-Aza-3-Oxaheptane |