|
CAS#: 83783-47-5 Product: 1-Chloro-4-(1-Chloro-1-Butenyl)Benzene No suppilers available for the product. |
| Name | 1-Chloro-4-(1-Chloro-1-Butenyl)Benzene |
|---|---|
| Synonyms | 1-Chloro-4-(1-Chloro-1-Butenyl)Benzene; Benaene, 1-Chloro-4-(1-Chloro-1-Butenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10Cl2 |
| Molecular Weight | 201.10 |
| CAS Registry Number | 83783-47-5 |
| EINECS | 280-780-9 |
| SMILES | C1=C(\C(Cl)=C\CC)C=CC(=C1)Cl |
| InChI | 1S/C10H10Cl2/c1-2-3-10(12)8-4-6-9(11)7-5-8/h3-7H,2H2,1H3/b10-3- |
| InChIKey | QFVHBWDSEZDIAV-KMKOMSMNSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.643°C at 760 mmHg (Cal.) |
| Flash point | 115.98°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-(1-Chloro-1-Butenyl)Benzene |