|
CAS#: 83833-33-4 Product: 1-Bromo-4-(1-Chlorobutenyl)Benzene No suppilers available for the product. |
| Name | 1-Bromo-4-(1-Chlorobutenyl)Benzene |
|---|---|
| Synonyms | 1-Bromo-4-(1-Chlorobutenyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10BrCl |
| Molecular Weight | 245.55 |
| CAS Registry Number | 83833-33-4 |
| EINECS | 281-008-3 |
| SMILES | C1=C(\C(Cl)=C\CC)C=CC(=C1)Br |
| InChI | 1S/C10H10BrCl/c1-2-3-10(12)8-4-6-9(11)7-5-8/h3-7H,2H2,1H3/b10-3- |
| InChIKey | WKDXWCCEMCZYBN-KMKOMSMNSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.987°C at 760 mmHg (Cal.) |
| Flash point | 155.668°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-4-(1-Chlorobutenyl)Benzene |