|
CAS#: 84304-18-7 Product: 3-Bromo-6-Methoxy-1-(4-Nitrophenoxy)Benzene No suppilers available for the product. |
| Name | 3-Bromo-6-Methoxy-1-(4-Nitrophenoxy)Benzene |
|---|---|
| Synonyms | 3-Bromo-6-Methoxy-1-(4-Nitrophenoxy)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10BrNO4 |
| Molecular Weight | 324.13 |
| CAS Registry Number | 84304-18-7 |
| EINECS | 282-703-4 |
| SMILES | C2=C(OC1=CC=C([N+]([O-])=O)C=C1)C(=CC=C2Br)OC |
| InChI | 1S/C13H10BrNO4/c1-18-12-7-2-9(14)8-13(12)19-11-5-3-10(4-6-11)15(16)17/h2-8H,1H3 |
| InChIKey | INITWIZQTGTCFY-UHFFFAOYSA-N |
| Density | 1.529g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.906°C at 760 mmHg (Cal.) |
| Flash point | 193.842°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-6-Methoxy-1-(4-Nitrophenoxy)Benzene |