|
CAS#: 849062-35-7 Product: (2-Bromo-3,4,5,6-tetrafluorophenyl)boronic acid No suppilers available for the product. |
| Name | (2-Bromo-3,4,5,6-tetrafluorophenyl)boronic acid |
|---|---|
| Synonyms | (2-Brom-3,4,5,6-tetrafluorphenyl)borsäure; (2-Bromo-3,4,5,6-tetrafluorophenyl)boronic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2BBrF4O2 |
| Molecular Weight | 272.79 |
| CAS Registry Number | 849062-35-7 |
| SMILES | B(c1c(c(c(c(c1Br)F)F)F)F)(O)O |
| InChI | 1S/C6H2BBrF4O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H |
| InChIKey | SNFARXZQGCXAEZ-UHFFFAOYSA-N |
| Density | 2.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.1±50.0°C at 760 mmHg (Cal.) |
| Flash point | 134.7±30.1°C (Cal.) |
| Refractive index | 1.507 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Bromo-3,4,5,6-tetrafluorophenyl)boronic acid |