|
CAS#: 84912-05-0 Product: 2-Chloro-3-(Diethylamino)-N,N-Diethyl-2-Butenamide No suppilers available for the product. |
| Name | 2-Chloro-3-(Diethylamino)-N,N-Diethyl-2-Butenamide |
|---|---|
| Synonyms | (Z)-2-Chloro-3-Diethylamino-N,N-Diethyl-But-2-Enamide; 2-Chloro-3-(Diethylamino)-N,N-Diethyl-2-Butenamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H23ClN2O |
| Molecular Weight | 246.78 |
| CAS Registry Number | 84912-05-0 |
| EINECS | 284-467-8 |
| SMILES | C(N(C(=O)\C(Cl)=C(N(CC)CC)/C)CC)C |
| InChI | 1S/C12H23ClN2O/c1-6-14(7-2)10(5)11(13)12(16)15(8-3)9-4/h6-9H2,1-5H3/b11-10- |
| InChIKey | DNCOGDDZCWZLQX-KHPPLWFESA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.655°C at 760 mmHg (Cal.) |
| Flash point | 160.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-3-(Diethylamino)-N,N-Diethyl-2-Butenamide |