|
CAS#: 84912-13-0 Product: Naphth[1,8-Cd]-1,2-Oxathiole-6-Sulphonic Acid 2,2-Dioxide No suppilers available for the product. |
| Name | Naphth[1,8-Cd]-1,2-Oxathiole-6-Sulphonic Acid 2,2-Dioxide |
|---|---|
| Synonyms | naphth[1,8-cd]-1,2-oxathiole-6-sulphonic acid 2,2-dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6O6S2 |
| Molecular Weight | 286.28 |
| CAS Registry Number | 84912-13-0 |
| EINECS | 284-476-7 |
| SMILES | c1cc2c(ccc3c2c(c1)S(=O)(=O)O3)S(=O)(=O)O |
| InChI | 1S/C10H6O6S2/c11-17(12,13)8-5-4-7-10-6(8)2-1-3-9(10)18(14,15)16-7/h1-5H,(H,11,12,13) |
| InChIKey | QAEUEWRTNVGJOO-UHFFFAOYSA-N |
| Density | 1.843g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Naphth[1,8-Cd]-1,2-Oxathiole-6-Sulphonic Acid 2,2-Dioxide |