|
CAS#: 84912-19-6 Product: 4-Isopropyl-5,5-Dimethyl-2-(1-Phenylethyl)-1,3-Dioxane No suppilers available for the product. |
| Name | 4-Isopropyl-5,5-Dimethyl-2-(1-Phenylethyl)-1,3-Dioxane |
|---|---|
| Synonyms | 4-Isopropyl-5,5-Dimethyl-2-(1-Phenylethyl)-1,3-Dioxane; Nciopen2_002138; Nsc55422 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 |
| CAS Registry Number | 84912-19-6 |
| EINECS | 284-483-5 |
| SMILES | C2=C(C(C1OC(C(CO1)(C)C)C(C)C)C)C=CC=C2 |
| InChI | 1S/C17H26O2/c1-12(2)15-17(4,5)11-18-16(19-15)13(3)14-9-7-6-8-10-14/h6-10,12-13,15-16H,11H2,1-5H3 |
| InChIKey | CPWDBSWFAGSNKH-UHFFFAOYSA-N |
| Density | 0.955g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.651°C at 760 mmHg (Cal.) |
| Flash point | 164.136°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Isopropyl-5,5-Dimethyl-2-(1-Phenylethyl)-1,3-Dioxane |