|
CAS#: 85030-51-9 Product: 2-[(1-Methylpropyl)Thio]Anthraquinone No suppilers available for the product. |
| Name | 2-[(1-Methylpropyl)Thio]Anthraquinone |
|---|---|
| Synonyms | 2-Sec-Butylsulfanylanthracene-9,10-Dione; 2-(Sec-Butylthio)Anthracene-9,10-Dione; 2-(Sec-Butylthio)-9,10-Anthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O2S |
| Molecular Weight | 296.38 |
| CAS Registry Number | 85030-51-9 |
| EINECS | 285-176-9 |
| SMILES | C1=C(SC(CC)C)C=CC2=C1C(=O)C3=C(C2=O)C=CC=C3 |
| InChI | 1S/C18H16O2S/c1-3-11(2)21-12-8-9-15-16(10-12)18(20)14-7-5-4-6-13(14)17(15)19/h4-11H,3H2,1-2H3 |
| InChIKey | QAWRKOAZXKWDJF-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.572°C at 760 mmHg (Cal.) |
| Flash point | 205.795°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(1-Methylpropyl)Thio]Anthraquinone |