|
CAS#: 85030-54-2 Product: 3-Formylbut-2-Endiyl Diacetate No suppilers available for the product. |
| Name | 3-Formylbut-2-Endiyl Diacetate |
|---|---|
| Synonyms | [(E)-3-Methyl-4-Oxo-But-2-Enyl] Acetate Acetate; Acetic Acid [(E)-3-Methyl-4-Oxobut-2-Enyl] Ester Acetate; Acetic Acid [(E)-4-Keto-3-Methyl-But-2-Enyl] Ester Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13O5 |
| Molecular Weight | 201.20 |
| CAS Registry Number | 85030-54-2 |
| EINECS | 285-180-0 |
| SMILES | C(OC(=O)C)\C=C(/C)C=O.CC([O-])=O |
| InChI | 1S/C7H10O3.C2H4O2/c1-6(5-8)3-4-10-7(2)9;1-2(3)4/h3,5H,4H2,1-2H3;1H3,(H,3,4)/p-1/b6-3+; |
| InChIKey | JGWDYCXIWONDLQ-ZIKNSQGESA-M |
| Boiling point | 371.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Formylbut-2-Endiyl Diacetate |