|
CAS#: 85204-17-7 Product: 2-Phenylethyl 2-Ethyl-2-Butenoate No suppilers available for the product. |
| Name | 2-Phenylethyl 2-Ethyl-2-Butenoate |
|---|---|
| Synonyms | (Z)-2-Ethylbut-2-Enoic Acid 2-Phenylethyl Ester; 2-Phenylethyl 2-Ethyl-2-Butenoate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 |
| CAS Registry Number | 85204-17-7 |
| EINECS | 286-311-4 |
| SMILES | C1=C(CCOC(=O)C(=C\C)/CC)C=CC=C1 |
| InChI | 1S/C14H18O2/c1-3-13(4-2)14(15)16-11-10-12-8-6-5-7-9-12/h3,5-9H,4,10-11H2,1-2H3/b13-3- |
| InChIKey | RCGVVLWESIDPJT-DXNYSGJVSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.314°C at 760 mmHg (Cal.) |
| Flash point | 175.255°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenylethyl 2-Ethyl-2-Butenoate |